C15H27NO2 — CID 68829384
3-(3-methoxyphenyl)-2-methylpentan-3-ol;N-methylmethanamine (PubChem CID 68829384) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2-methylpentan-3-ol;N-methylmethanamine.
| Compound Name | 3-(3-methoxyphenyl)-2-methylpentan-3-ol;N-methylmethanamine |
|---|---|
| PubChem CID | 68829384 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 3-(3-methoxyphenyl)-2-methylpentan-3-ol;N-methylmethanamine |
| SMILES | CCC(O)(c1cccc(OC)c1)C(C)C.CNC |
| InChI | InChI=1S/C13H20O2.C2H7N/c1-5-13(14,10(2)3)11-7-6-8-12(9-11)15-4;1-3-2/h6-10,14H,5H2,1-4H3;3H,1-2H3 |
| InChIKey | KESSECDHJFASDL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |