C15H25NO2 — CID 69117113
(3R,4R)-1-amino-3-(3-methoxyphenyl)-4,5-dimethylhexan-3-ol (PubChem CID 69117113) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is (3R,4R)-1-amino-3-(3-methoxyphenyl)-4,5-dimethylhexan-3-ol.
| Compound Name | (3R,4R)-1-amino-3-(3-methoxyphenyl)-4,5-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 69117113 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | (3R,4R)-1-amino-3-(3-methoxyphenyl)-4,5-dimethylhexan-3-ol |
| SMILES | COc1cccc([C@@](O)(CCN)[C@H](C)C(C)C)c1 |
| InChI | InChI=1S/C15H25NO2/c1-11(2)12(3)15(17,8-9-16)13-6-5-7-14(10-13)18-4/h5-7,10-12,17H,8-9,16H2,1-4H3/t12-,15-/m1/s1 |
| InChIKey | CNEBLJDVEUVGEH-IUODEOHRSA-N |
| XLogP | 2.52 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |