C24H21F13O2 — CID 162348337
1-(4-butan-2-yloxyphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol (PubChem CID 162348337) has the molecular formula C24H21F13O2 and a molecular weight of 588.40 g/mol. Its IUPAC name is 1-(4-butan-2-yloxyphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol.
| Compound Name | 1-(4-butan-2-yloxyphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol |
|---|---|
| PubChem CID | 162348337 |
| Molecular Formula | C24H21F13O2 |
| Molecular Weight | 588.40 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 1-(4-butan-2-yloxyphenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol |
| SMILES | CCC(C)Oc1ccc(C(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21F13O2/c1-3-14(2)39-17-11-9-16(10-12-17)18(38,15-7-5-4-6-8-15)13-19(25,26)20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37/h4-12,14,38H,3,13H2,1-2H3 |
| InChIKey | QZJMIVPIUPQPQR-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.40 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|