C22H18F13NO — CID 162348335
1-[4-(dimethylamino)phenyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol (PubChem CID 162348335) has the molecular formula C22H18F13NO and a molecular weight of 559.37 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol |
|---|---|
| PubChem CID | 162348335 |
| Molecular Formula | C22H18F13NO |
| Molecular Weight | 559.37 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol |
| SMILES | CN(C)c1ccc(C(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18F13NO/c1-36(2)15-10-8-14(9-11-15)16(37,13-6-4-3-5-7-13)12-17(23,24)18(25,26)19(27,28)20(29,30)21(31,32)22(33,34)35/h3-11,37H,12H2,1-2H3 |
| InChIKey | YNFAHQOFDBNRGE-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.37 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|