C20H12ClF13O — CID 162347445
1-(3-chlorophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol (PubChem CID 162347445) has the molecular formula C20H12ClF13O and a molecular weight of 550.74 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol.
| Compound Name | 1-(3-chlorophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol |
|---|---|
| PubChem CID | 162347445 |
| Molecular Formula | C20H12ClF13O |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | 1-(3-chlorophenyl)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-phenyloctan-1-ol |
| SMILES | OC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c1ccccc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H12ClF13O/c21-13-8-4-7-12(9-13)14(35,11-5-2-1-3-6-11)10-15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)20(32,33)34/h1-9,35H,10H2 |
| InChIKey | XIXFZHUGTTXLMY-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|