C15H12ClF11O — CID 156763952
1-chloro-3-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene (PubChem CID 156763952) has the molecular formula C15H12ClF11O and a molecular weight of 452.69 g/mol. Its IUPAC name is 1-chloro-3-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene.
| Compound Name | 1-chloro-3-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene |
|---|---|
| PubChem CID | 156763952 |
| Molecular Formula | C15H12ClF11O |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 1-chloro-3-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClF11O/c1-10(28-2,8-4-3-5-9(16)6-8)7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)27/h3-6H,7H2,1-2H3 |
| InChIKey | MJMJBKRPCWKIAI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|