C20H17F15O3 — CID 156764366
ethyl 3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methoxydecan-2-yl)benzoate (PubChem CID 156764366) has the molecular formula C20H17F15O3 and a molecular weight of 590.32 g/mol. Its IUPAC name is ethyl 3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methoxydecan-2-yl)benzoate.
| Compound Name | ethyl 3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methoxydecan-2-yl)benzoate |
|---|---|
| PubChem CID | 156764366 |
| Molecular Formula | C20H17F15O3 |
| Molecular Weight | 590.32 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | ethyl 3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methoxydecan-2-yl)benzoate |
| SMILES | CCOC(=O)c1cccc(C(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC)c1 |
| InChI | InChI=1S/C20H17F15O3/c1-4-38-12(36)10-6-5-7-11(8-10)13(2,37-3)9-14(21,22)15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)35/h5-8H,4,9H2,1-3H3 |
| InChIKey | UGFGPBAOGLVPQE-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.32 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|