C18H17F11O3 — CID 156763351
ethyl 3-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzoate (PubChem CID 156763351) has the molecular formula C18H17F11O3 and a molecular weight of 490.31 g/mol. Its IUPAC name is ethyl 3-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzoate.
| Compound Name | ethyl 3-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzoate |
|---|---|
| PubChem CID | 156763351 |
| Molecular Formula | C18H17F11O3 |
| Molecular Weight | 490.31 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | ethyl 3-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzoate |
| SMILES | CCOC(=O)c1cccc(C(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC)c1 |
| InChI | InChI=1S/C18H17F11O3/c1-4-32-12(30)10-6-5-7-11(8-10)13(2,31-3)9-14(19,20)15(21,22)16(23,24)17(25,26)18(27,28)29/h5-8H,4,9H2,1-3H3 |
| InChIKey | LCHAJQQOLFGASF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.31 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|