C14H12F9IO — CID 156763960
1-iodo-4-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene (PubChem CID 156763960) has the molecular formula C14H12F9IO and a molecular weight of 494.14 g/mol. Its IUPAC name is 1-iodo-4-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene.
| Compound Name | 1-iodo-4-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene |
|---|---|
| PubChem CID | 156763960 |
| Molecular Formula | C14H12F9IO |
| Molecular Weight | 494.14 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | 1-iodo-4-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H12F9IO/c1-10(25-2,8-3-5-9(24)6-4-8)7-11(15,16)12(17,18)13(19,20)14(21,22)23/h3-6H,7H2,1-2H3 |
| InChIKey | WQPBYEXVEGLKOM-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.14 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|