C18H21F9O — CID 156765136
1-butan-2-yl-4-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene (PubChem CID 156765136) has the molecular formula C18H21F9O and a molecular weight of 424.35 g/mol. Its IUPAC name is 1-butan-2-yl-4-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene.
| Compound Name | 1-butan-2-yl-4-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene |
|---|---|
| PubChem CID | 156765136 |
| Molecular Formula | C18H21F9O |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-butan-2-yl-4-(4,4,5,5,6,6,7,7,7-nonafluoro-2-methoxyheptan-2-yl)benzene |
| SMILES | CCC(C)c1ccc(C(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC)cc1 |
| InChI | InChI=1S/C18H21F9O/c1-5-11(2)12-6-8-13(9-7-12)14(3,28-4)10-15(19,20)16(21,22)17(23,24)18(25,26)27/h6-9,11H,5,10H2,1-4H3 |
| InChIKey | HREMPHMBQHBHGR-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|