C17H21F7O — CID 156764195
1-tert-butyl-4-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene (PubChem CID 156764195) has the molecular formula C17H21F7O and a molecular weight of 374.34 g/mol. Its IUPAC name is 1-tert-butyl-4-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene.
| Compound Name | 1-tert-butyl-4-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene |
|---|---|
| PubChem CID | 156764195 |
| Molecular Formula | C17H21F7O |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 1-tert-butyl-4-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)F)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H21F7O/c1-13(2,3)11-6-8-12(9-7-11)14(4,25-5)10-15(18,19)16(20,21)17(22,23)24/h6-9H,10H2,1-5H3 |
| InChIKey | PTCZVBQPCSZQKE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|