C16H19F7O — CID 156765928
1-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)-2-propan-2-ylbenzene (PubChem CID 156765928) has the molecular formula C16H19F7O and a molecular weight of 360.31 g/mol. Its IUPAC name is 1-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)-2-propan-2-ylbenzene.
| Compound Name | 1-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 156765928 |
| Molecular Formula | C16H19F7O |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-(4,4,5,5,6,6,6-heptafluoro-2-methoxyhexan-2-yl)-2-propan-2-ylbenzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)F)c1ccccc1C(C)C |
| InChI | InChI=1S/C16H19F7O/c1-10(2)11-7-5-6-8-12(11)13(3,24-4)9-14(17,18)15(19,20)16(21,22)23/h5-8,10H,9H2,1-4H3 |
| InChIKey | RWXPXVBYBJEMHS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|