C17H12ClF15O — CID 156764253
1-chloro-2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methoxydecan-2-yl)benzene (PubChem CID 156764253) has the molecular formula C17H12ClF15O and a molecular weight of 552.71 g/mol. Its IUPAC name is 1-chloro-2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methoxydecan-2-yl)benzene.
| Compound Name | 1-chloro-2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methoxydecan-2-yl)benzene |
|---|---|
| PubChem CID | 156764253 |
| Molecular Formula | C17H12ClF15O |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.03 |
| IUPAC Name | 1-chloro-2-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methoxydecan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1Cl |
| InChI | InChI=1S/C17H12ClF15O/c1-10(34-2,8-5-3-4-6-9(8)18)7-11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)33/h3-6H,7H2,1-2H3 |
| InChIKey | CSVCMIBBVTZYMR-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|