C22H17F13O — CID 156763768
1-phenyl-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)benzene (PubChem CID 156763768) has the molecular formula C22H17F13O and a molecular weight of 544.35 g/mol. Its IUPAC name is 1-phenyl-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)benzene.
| Compound Name | 1-phenyl-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)benzene |
|---|---|
| PubChem CID | 156763768 |
| Molecular Formula | C22H17F13O |
| Molecular Weight | 544.35 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 1-phenyl-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H17F13O/c1-16(36-2,15-11-7-6-10-14(15)13-8-4-3-5-9-13)12-17(23,24)18(25,26)19(27,28)20(29,30)21(31,32)22(33,34)35/h3-11H,12H2,1-2H3 |
| InChIKey | OJCRHTBHHDJCRD-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.35 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|