C19H21F11O2 — CID 156765220
1-butan-2-yloxy-2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene (PubChem CID 156765220) has the molecular formula C19H21F11O2 and a molecular weight of 490.35 g/mol. Its IUPAC name is 1-butan-2-yloxy-2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene.
| Compound Name | 1-butan-2-yloxy-2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene |
|---|---|
| PubChem CID | 156765220 |
| Molecular Formula | C19H21F11O2 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 1-butan-2-yloxy-2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene |
| SMILES | CCC(C)Oc1ccccc1C(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C19H21F11O2/c1-5-11(2)32-13-9-7-6-8-12(13)14(3,31-4)10-15(20,21)16(22,23)17(24,25)18(26,27)19(28,29)30/h6-9,11H,5,10H2,1-4H3 |
| InChIKey | GJUUIYVDMBVKHZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|