C16H12F13IO — CID 156765217
1-iodo-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)benzene (PubChem CID 156765217) has the molecular formula C16H12F13IO and a molecular weight of 594.15 g/mol. Its IUPAC name is 1-iodo-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)benzene.
| Compound Name | 1-iodo-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)benzene |
|---|---|
| PubChem CID | 156765217 |
| Molecular Formula | C16H12F13IO |
| Molecular Weight | 594.15 g/mol |
| Exact Mass | 593.97 |
| IUPAC Name | 1-iodo-2-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-methoxynonan-2-yl)benzene |
| SMILES | COC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1I |
| InChI | InChI=1S/C16H12F13IO/c1-10(31-2,8-5-3-4-6-9(8)30)7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h3-6H,7H2,1-2H3 |
| InChIKey | YJNRNDOGOAXPBN-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.15 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|