C18H19F11O — CID 156765872
1-propyl-2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene (PubChem CID 156765872) has the molecular formula C18H19F11O and a molecular weight of 460.33 g/mol. Its IUPAC name is 1-propyl-2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene.
| Compound Name | 1-propyl-2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene |
|---|---|
| PubChem CID | 156765872 |
| Molecular Formula | C18H19F11O |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 1-propyl-2-(4,4,5,5,6,6,7,7,8,8,8-undecafluoro-2-methoxyoctan-2-yl)benzene |
| SMILES | CCCc1ccccc1C(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C18H19F11O/c1-4-7-11-8-5-6-9-12(11)13(2,30-3)10-14(19,20)15(21,22)16(23,24)17(25,26)18(27,28)29/h5-6,8-9H,4,7,10H2,1-3H3 |
| InChIKey | KFPOBUQUHXVYGJ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|