C15H19F5O2 — CID 156764378
2-(2-butan-2-yloxyphenyl)-4,4,5,5,5-pentafluoropentan-2-ol (PubChem CID 156764378) has the molecular formula C15H19F5O2 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-(2-butan-2-yloxyphenyl)-4,4,5,5,5-pentafluoropentan-2-ol.
| Compound Name | 2-(2-butan-2-yloxyphenyl)-4,4,5,5,5-pentafluoropentan-2-ol |
|---|---|
| PubChem CID | 156764378 |
| Molecular Formula | C15H19F5O2 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(2-butan-2-yloxyphenyl)-4,4,5,5,5-pentafluoropentan-2-ol |
| SMILES | CCC(C)Oc1ccccc1C(C)(O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H19F5O2/c1-4-10(2)22-12-8-6-5-7-11(12)13(3,21)9-14(16,17)15(18,19)20/h5-8,10,21H,4,9H2,1-3H3 |
| InChIKey | HNJRSKJRASRQFC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|