C15H17F7O2 — CID 156764380
4,4,5,5,6,6,6-heptafluoro-2-(2-propan-2-yloxyphenyl)hexan-2-ol (PubChem CID 156764380) has the molecular formula C15H17F7O2 and a molecular weight of 362.29 g/mol. Its IUPAC name is 4,4,5,5,6,6,6-heptafluoro-2-(2-propan-2-yloxyphenyl)hexan-2-ol.
| Compound Name | 4,4,5,5,6,6,6-heptafluoro-2-(2-propan-2-yloxyphenyl)hexan-2-ol |
|---|---|
| PubChem CID | 156764380 |
| Molecular Formula | C15H17F7O2 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4,4,5,5,6,6,6-heptafluoro-2-(2-propan-2-yloxyphenyl)hexan-2-ol |
| SMILES | CC(C)Oc1ccccc1C(C)(O)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H17F7O2/c1-9(2)24-11-7-5-4-6-10(11)12(3,23)8-13(16,17)14(18,19)15(20,21)22/h4-7,9,23H,8H2,1-3H3 |
| InChIKey | ITSKRHKHWLUXNR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|