C18H30O2 — CID 114865145
2,6-dimethyl-4-(2-propan-2-yloxyphenyl)heptan-4-ol (PubChem CID 114865145) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2-propan-2-yloxyphenyl)heptan-4-ol.
| Compound Name | 2,6-dimethyl-4-(2-propan-2-yloxyphenyl)heptan-4-ol |
|---|---|
| PubChem CID | 114865145 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2,6-dimethyl-4-(2-propan-2-yloxyphenyl)heptan-4-ol |
| SMILES | CC(C)CC(O)(CC(C)C)c1ccccc1OC(C)C |
| InChI | InChI=1S/C18H30O2/c1-13(2)11-18(19,12-14(3)4)16-9-7-8-10-17(16)20-15(5)6/h7-10,13-15,19H,11-12H2,1-6H3 |
| InChIKey | PQAHHSTWZQUBIT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |