C28H35NO3 — CID 13210134
2-(methylamino)-3-phenyl-1,1-bis(2-propan-2-yloxyphenyl)propan-1-ol (PubChem CID 13210134) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is 2-(methylamino)-3-phenyl-1,1-bis(2-propan-2-yloxyphenyl)propan-1-ol.
| Compound Name | 2-(methylamino)-3-phenyl-1,1-bis(2-propan-2-yloxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 13210134 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 2-(methylamino)-3-phenyl-1,1-bis(2-propan-2-yloxyphenyl)propan-1-ol |
| SMILES | CNC(Cc1ccccc1)C(O)(c1ccccc1OC(C)C)c1ccccc1OC(C)C |
| InChI | InChI=1S/C28H35NO3/c1-20(2)31-25-17-11-9-15-23(25)28(30,24-16-10-12-18-26(24)32-21(3)4)27(29-5)19-22-13-7-6-8-14-22/h6-18,20-21,27,29-30H,19H2,1-5H3 |
| InChIKey | OSEQCGBFFSSLIX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |