C17H20O4 — CID 7707238
(2S)-1,1-bis(2-methoxyphenyl)propane-1,2-diol (PubChem CID 7707238) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (2S)-1,1-bis(2-methoxyphenyl)propane-1,2-diol.
| Compound Name | (2S)-1,1-bis(2-methoxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 7707238 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2S)-1,1-bis(2-methoxyphenyl)propane-1,2-diol |
| SMILES | COc1ccccc1C(O)(c1ccccc1OC)[C@H](C)O |
| InChI | InChI=1S/C17H20O4/c1-12(18)17(19,13-8-4-6-10-15(13)20-2)14-9-5-7-11-16(14)21-3/h4-12,18-19H,1-3H3/t12-/m0/s1 |
| InChIKey | ICHXPQLRGLLPPL-LBPRGKRZSA-N |
| XLogP | 2.32 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |