C24H37NO4Si — CID 139745305
2-amino-3-[tert-butyl(dimethyl)silyl]oxy-1,1-bis(2-methoxyphenyl)butan-1-ol (PubChem CID 139745305) has the molecular formula C24H37NO4Si and a molecular weight of 431.65 g/mol. Its IUPAC name is 2-amino-3-[tert-butyl(dimethyl)silyl]oxy-1,1-bis(2-methoxyphenyl)butan-1-ol.
| Compound Name | 2-amino-3-[tert-butyl(dimethyl)silyl]oxy-1,1-bis(2-methoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 139745305 |
| Molecular Formula | C24H37NO4Si |
| Molecular Weight | 431.65 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 2-amino-3-[tert-butyl(dimethyl)silyl]oxy-1,1-bis(2-methoxyphenyl)butan-1-ol |
| SMILES | COc1ccccc1C(O)(c1ccccc1OC)C(N)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H37NO4Si/c1-17(29-30(7,8)23(2,3)4)22(25)24(26,18-13-9-11-15-20(18)27-5)19-14-10-12-16-21(19)28-6/h9-17,22,26H,25H2,1-8H3 |
| InChIKey | ODRZATJUKXHXMC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|