C13H20O2 — CID 591994
2-(2-methoxyphenyl)-3,3-dimethylbutan-2-ol (PubChem CID 591994) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-3,3-dimethylbutan-2-ol.
| Compound Name | 2-(2-methoxyphenyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 591994 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-(2-methoxyphenyl)-3,3-dimethylbutan-2-ol |
| SMILES | COc1ccccc1C(C)(O)C(C)(C)C |
| InChI | InChI=1S/C13H20O2/c1-12(2,3)13(4,14)10-8-6-7-9-11(10)15-5/h6-9,14H,1-5H3 |
| InChIKey | ZRARASAOFQXBDZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |