C13H31NOSi — CID 15632284
(3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpentan-3-amine (PubChem CID 15632284) has the molecular formula C13H31NOSi and a molecular weight of 245.48 g/mol. Its IUPAC name is (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpentan-3-amine.
| Compound Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 15632284 |
| Molecular Formula | C13H31NOSi |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | (3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpentan-3-amine |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C13H31NOSi/c1-10(11(14)12(2,3)4)15-16(8,9)13(5,6)7/h10-11H,14H2,1-9H3/t10-,11+/m0/s1 |
| InChIKey | FDDLDAOZXDKWHQ-WDEREUQCSA-N |
| XLogP | 3.77 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|