C11H23BrO2Si — CID 101390740
(3R,4R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-ol (PubChem CID 101390740) has the molecular formula C11H23BrO2Si and a molecular weight of 295.29 g/mol. Its IUPAC name is (3R,4R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-ol.
| Compound Name | (3R,4R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-ol |
|---|---|
| PubChem CID | 101390740 |
| Molecular Formula | C11H23BrO2Si |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (3R,4R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxypent-1-en-3-ol |
| SMILES | C=C(Br)[C@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H23BrO2Si/c1-8(12)10(13)9(2)14-15(6,7)11(3,4)5/h9-10,13H,1H2,2-7H3/t9-,10+/m1/s1 |
| InChIKey | DKJNPFQPXSTHOB-ZJUUUORDSA-N |
| XLogP | 3.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|