C16H34O2Si2 — CID 101162769
(2S,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-trimethylsilylhex-5-yn-3-ol (PubChem CID 101162769) has the molecular formula C16H34O2Si2 and a molecular weight of 314.62 g/mol. Its IUPAC name is (2S,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-trimethylsilylhex-5-yn-3-ol.
| Compound Name | (2S,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-trimethylsilylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 101162769 |
| Molecular Formula | C16H34O2Si2 |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (2S,3S,4S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-trimethylsilylhex-5-yn-3-ol |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H34O2Si2/c1-13(11-12-19(6,7)8)15(17)14(2)18-20(9,10)16(3,4)5/h13-15,17H,1-10H3/t13-,14-,15-/m0/s1 |
| InChIKey | RLFVNMRBSXTLMB-KKUMJFAQSA-N |
| XLogP | 4.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|