C18H36O3Si2 — CID 101168220
[(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-trimethylsilylhex-5-yn-3-yl] acetate (PubChem CID 101168220) has the molecular formula C18H36O3Si2 and a molecular weight of 356.66 g/mol. Its IUPAC name is [(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-trimethylsilylhex-5-yn-3-yl] acetate.
| Compound Name | [(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-trimethylsilylhex-5-yn-3-yl] acetate |
|---|---|
| PubChem CID | 101168220 |
| Molecular Formula | C18H36O3Si2 |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [(2S,3R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-6-trimethylsilylhex-5-yn-3-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](C)C#C[Si](C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si2/c1-14(12-13-22(7,8)9)17(20-16(3)19)15(2)21-23(10,11)18(4,5)6/h14-15,17H,1-11H3/t14-,15+,17-/m1/s1 |
| InChIKey | ZDVIMJZWSKPOIZ-HLLBOEOZSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|