C22H48O3Si2 — CID 11732481
(E,5S,6S,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloct-3-en-2-ol (PubChem CID 11732481) has the molecular formula C22H48O3Si2 and a molecular weight of 416.80 g/mol. Its IUPAC name is (E,5S,6S,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloct-3-en-2-ol.
| Compound Name | (E,5S,6S,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloct-3-en-2-ol |
|---|---|
| PubChem CID | 11732481 |
| Molecular Formula | C22H48O3Si2 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.31 |
| IUPAC Name | (E,5S,6S,7S)-6,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3,5-dimethyloct-3-en-2-ol |
| SMILES | C/C(=C\[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C)C(C)O |
| InChI | InChI=1S/C22H48O3Si2/c1-16(18(3)23)15-17(2)20(25-27(13,14)22(8,9)10)19(4)24-26(11,12)21(5,6)7/h15,17-20,23H,1-14H3/b16-15+/t17-,18?,19-,20-/m0/s1 |
| InChIKey | MZUBMKDDTVNTAO-ZOJSKXEMSA-N |
| XLogP | 6.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|