C34H48IOPSi — CID 101266693
[(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-5-enyl]-iodo-triphenyl-λ5-phosphane (PubChem CID 101266693) has the molecular formula C34H48IOPSi and a molecular weight of 658.72 g/mol. Its IUPAC name is [(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-5-enyl]-iodo-triphenyl-λ5-phosphane.
| Compound Name | [(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-5-enyl]-iodo-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 101266693 |
| Molecular Formula | C34H48IOPSi |
| Molecular Weight | 658.72 g/mol |
| Exact Mass | 658.23 |
| IUPAC Name | [(2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylhept-5-enyl]-iodo-triphenyl-λ5-phosphane |
| SMILES | CC(C)=C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CP(I)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H48IOPSi/c1-27(2)25-28(3)33(36-38(8,9)34(5,6)7)29(4)26-37(35,30-19-13-10-14-20-30,31-21-15-11-16-22-31)32-23-17-12-18-24-32/h10-25,28-29,33H,26H2,1-9H3/t28-,29-,33+/m0/s1 |
| InChIKey | YNFJSTGOYNQICZ-XNMCCTNNSA-N |
| XLogP | 9.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.72 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|