C44H76O4Si2 — CID 102287789
tert-butyl-[(3R,4S,5S,9S,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethyl-7-methylidene-5,9-bis[(1S)-1-phenylethoxy]tridecan-3-yl]oxy-dimethylsilane (PubChem CID 102287789) has the molecular formula C44H76O4Si2 and a molecular weight of 725.26 g/mol. Its IUPAC name is tert-butyl-[(3R,4S,5S,9S,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethyl-7-methylidene-5,9-bis[(1S)-1-phenylethoxy]tridecan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4S,5S,9S,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethyl-7-methylidene-5,9-bis[(1S)-1-phenylethoxy]tridecan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102287789 |
| Molecular Formula | C44H76O4Si2 |
| Molecular Weight | 725.26 g/mol |
| Exact Mass | 724.53 |
| IUPAC Name | tert-butyl-[(3R,4S,5S,9S,10S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-4,10-dimethyl-7-methylidene-5,9-bis[(1S)-1-phenylethoxy]tridecan-3-yl]oxy-dimethylsilane |
| SMILES | C=C(C[C@H](O[C@@H](C)c1ccccc1)[C@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C)C[C@H](O[C@@H](C)c1ccccc1)[C@H](C)[C@@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C44H76O4Si2/c1-18-39(47-49(14,15)43(8,9)10)33(4)41(45-35(6)37-26-22-20-23-27-37)30-32(3)31-42(46-36(7)38-28-24-21-25-29-38)34(5)40(19-2)48-50(16,17)44(11,12)13/h20-29,33-36,39-42H,3,18-19,30-31H2,1-2,4-17H3/t33-,34-,35+,36+,39-,40-,41+,42+/m1/s1 |
| InChIKey | AFKCNPDEXAGHFY-ZPFLKVODSA-N |
| XLogP | 13.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.26 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|