C25H44O3Si — CID 11531865
tert-butyl-dimethyl-[(4R,8R)-8-methyl-6-methylidene-9-(phenylmethoxymethoxy)nonan-4-yl]oxysilane (PubChem CID 11531865) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(4R,8R)-8-methyl-6-methylidene-9-(phenylmethoxymethoxy)nonan-4-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(4R,8R)-8-methyl-6-methylidene-9-(phenylmethoxymethoxy)nonan-4-yl]oxysilane |
|---|---|
| PubChem CID | 11531865 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | tert-butyl-dimethyl-[(4R,8R)-8-methyl-6-methylidene-9-(phenylmethoxymethoxy)nonan-4-yl]oxysilane |
| SMILES | C=C(C[C@@H](C)COCOCc1ccccc1)C[C@@H](CCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O3Si/c1-9-13-24(28-29(7,8)25(4,5)6)17-21(2)16-22(3)18-26-20-27-19-23-14-11-10-12-15-23/h10-12,14-15,22,24H,2,9,13,16-20H2,1,3-8H3/t22-,24-/m1/s1 |
| InChIKey | XZWKLDUXQJJNLM-ISKFKSNPSA-N |
| XLogP | 7.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|