C21H37O6PSi — CID 71514831
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-6-phenylmethoxyhexan-2-one (PubChem CID 71514831) has the molecular formula C21H37O6PSi and a molecular weight of 444.58 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-6-phenylmethoxyhexan-2-one.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-6-phenylmethoxyhexan-2-one |
|---|---|
| PubChem CID | 71514831 |
| Molecular Formula | C21H37O6PSi |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-1-dimethoxyphosphoryl-6-phenylmethoxyhexan-2-one |
| SMILES | COP(=O)(CC(=O)C[C@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C21H37O6PSi/c1-21(2,3)29(6,7)27-20(15-19(22)17-28(23,24-4)25-5)13-14-26-16-18-11-9-8-10-12-18/h8-12,20H,13-17H2,1-7H3/t20-/m0/s1 |
| InChIKey | VFGGUGYWLNMFJK-FQEVSTJZSA-N |
| XLogP | 5.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|