C24H40O5S2Si — CID 11123955
ethyl 2-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-phenylmethoxypentyl]-1,3-dithiolane-2-carboxylate (PubChem CID 11123955) has the molecular formula C24H40O5S2Si and a molecular weight of 500.80 g/mol. Its IUPAC name is ethyl 2-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-phenylmethoxypentyl]-1,3-dithiolane-2-carboxylate.
| Compound Name | ethyl 2-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-phenylmethoxypentyl]-1,3-dithiolane-2-carboxylate |
|---|---|
| PubChem CID | 11123955 |
| Molecular Formula | C24H40O5S2Si |
| Molecular Weight | 500.80 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | ethyl 2-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5-phenylmethoxypentyl]-1,3-dithiolane-2-carboxylate |
| SMILES | CCOC(=O)C1([C@H](O)C[C@H](CCOCc2ccccc2)O[Si](C)(C)C(C)(C)C)SCCS1 |
| InChI | InChI=1S/C24H40O5S2Si/c1-7-28-22(26)24(30-15-16-31-24)21(25)17-20(29-32(5,6)23(2,3)4)13-14-27-18-19-11-9-8-10-12-19/h8-12,20-21,25H,7,13-18H2,1-6H3/t20-,21+/m0/s1 |
| InChIKey | OPDBTBSUKCMOPA-LEWJYISDSA-N |
| XLogP | 5.47 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.80 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|