C21H36O4Si — CID 101483549
ethyl (4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-7-phenylheptanoate (PubChem CID 101483549) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is ethyl (4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-7-phenylheptanoate.
| Compound Name | ethyl (4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-7-phenylheptanoate |
|---|---|
| PubChem CID | 101483549 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | ethyl (4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-7-phenylheptanoate |
| SMILES | CCOC(=O)CC[C@H](O)C[C@@H](Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O4Si/c1-7-24-20(23)14-13-18(22)16-19(15-17-11-9-8-10-12-17)25-26(5,6)21(2,3)4/h8-12,18-19,22H,7,13-16H2,1-6H3/t18-,19+/m0/s1 |
| InChIKey | ACXDDAVWFDNYQJ-RBUKOAKNSA-N |
| XLogP | 4.71 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|