C28H46O5S2Si — CID 11180433
ethyl (5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-8-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]octanoate (PubChem CID 11180433) has the molecular formula C28H46O5S2Si and a molecular weight of 554.89 g/mol. Its IUPAC name is ethyl (5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-8-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]octanoate.
| Compound Name | ethyl (5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-8-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]octanoate |
|---|---|
| PubChem CID | 11180433 |
| Molecular Formula | C28H46O5S2Si |
| Molecular Weight | 554.89 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | ethyl (5R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-8-[2-[(E)-2-phenylethenyl]-1,3-dithian-2-yl]octanoate |
| SMILES | CCOC(=O)CC(O)C[C@@H](O)C[C@@H](CC1(/C=C/c2ccccc2)SCCCS1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H46O5S2Si/c1-7-32-26(31)20-24(30)18-23(29)19-25(33-36(5,6)27(2,3)4)21-28(34-16-11-17-35-28)15-14-22-12-9-8-10-13-22/h8-10,12-15,23-25,29-30H,7,11,16-21H2,1-6H3/b15-14+/t23-,24?,25+/m1/s1 |
| InChIKey | JVIHJSOMWSFZKU-YDRDGYOISA-N |
| XLogP | 6.50 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.89 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|