C33H58O3S4Si — CID 101388834
(2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(2-hexyl-1,3-dithian-2-yl)propyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-ol (PubChem CID 101388834) has the molecular formula C33H58O3S4Si and a molecular weight of 659.18 g/mol. Its IUPAC name is (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(2-hexyl-1,3-dithian-2-yl)propyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(2-hexyl-1,3-dithian-2-yl)propyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 101388834 |
| Molecular Formula | C33H58O3S4Si |
| Molecular Weight | 659.18 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | (2R)-1-[2-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(2-hexyl-1,3-dithian-2-yl)propyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-ol |
| SMILES | CCCCCCC1(C[C@@H](CC2(C[C@@H](O)COCc3ccccc3)SCCCS2)O[Si](C)(C)C(C)(C)C)SCCCS1 |
| InChI | InChI=1S/C33H58O3S4Si/c1-7-8-9-13-18-32(37-19-14-20-38-32)24-30(36-41(5,6)31(2,3)4)25-33(39-21-15-22-40-33)23-29(34)27-35-26-28-16-11-10-12-17-28/h10-12,16-17,29-30,34H,7-9,13-15,18-27H2,1-6H3/t29-,30+/m1/s1 |
| InChIKey | LCDBJDJRRZPTFR-IHLOFXLRSA-N |
| XLogP | 10.23 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.18 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|