C20H33LiO2S2Si — CID 25208930
lithium (2R)-1-[2-[tert-butyl(dimethyl)silyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-olate (PubChem CID 25208930) has the molecular formula C20H33LiO2S2Si and a molecular weight of 404.64 g/mol. Its IUPAC name is lithium (2R)-1-[2-[tert-butyl(dimethyl)silyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-olate.
| Compound Name | lithium (2R)-1-[2-[tert-butyl(dimethyl)silyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-olate |
|---|---|
| PubChem CID | 25208930 |
| Molecular Formula | C20H33LiO2S2Si |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | lithium (2R)-1-[2-[tert-butyl(dimethyl)silyl]-1,3-dithian-2-yl]-3-phenylmethoxypropan-2-olate |
| SMILES | CC(C)(C)[Si](C)(C)C1(C[C@@H]([O-])COCc2ccccc2)SCCCS1.[Li+] |
| InChI | InChI=1S/C20H33O2S2Si.Li/c1-19(2,3)25(4,5)20(23-12-9-13-24-20)14-18(21)16-22-15-17-10-7-6-8-11-17;/h6-8,10-11,18H,9,12-16H2,1-5H3;/q-1;+1/t18-;/m1./s1 |
| InChIKey | XQMYTLQSVZCREJ-GMUIIQOCSA-N |
| XLogP | 1.94 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|