C36H58O4S2Si2 — CID 11319886
tert-butyl-[[(8R,9S,10S,11R)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-bis(phenylmethoxy)-1,5-dithiaspiro[5.6]dodecan-11-yl]oxy]-dimethylsilane (PubChem CID 11319886) has the molecular formula C36H58O4S2Si2 and a molecular weight of 675.16 g/mol. Its IUPAC name is tert-butyl-[[(8R,9S,10S,11R)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-bis(phenylmethoxy)-1,5-dithiaspiro[5.6]dodecan-11-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8R,9S,10S,11R)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-bis(phenylmethoxy)-1,5-dithiaspiro[5.6]dodecan-11-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11319886 |
| Molecular Formula | C36H58O4S2Si2 |
| Molecular Weight | 675.16 g/mol |
| Exact Mass | 674.33 |
| IUPAC Name | tert-butyl-[[(8R,9S,10S,11R)-8-[tert-butyl(dimethyl)silyl]oxy-9,10-bis(phenylmethoxy)-1,5-dithiaspiro[5.6]dodecan-11-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC2(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCc3ccccc3)[C@@H]1OCc1ccccc1)SCCCS2 |
| InChI | InChI=1S/C36H58O4S2Si2/c1-34(2,3)43(7,8)39-30-24-36(41-22-17-23-42-36)25-31(40-44(9,10)35(4,5)6)33(38-27-29-20-15-12-16-21-29)32(30)37-26-28-18-13-11-14-19-28/h11-16,18-21,30-33H,17,22-27H2,1-10H3/t30-,31-,32-,33-/m1/s1 |
| InChIKey | KQTMFUROZNQXLB-XEXPGFJZSA-N |
| XLogP | 10.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.16 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|