C20H34O4Si — CID 101116684
(1S,2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-phenylmethoxycyclohexan-1-ol (PubChem CID 101116684) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is (1S,2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-phenylmethoxycyclohexan-1-ol.
| Compound Name | (1S,2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-phenylmethoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 101116684 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (1S,2S,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(hydroxymethyl)-5-phenylmethoxycyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](OCc2ccccc2)C[C@H](O)[C@@H]1CO |
| InChI | InChI=1S/C20H34O4Si/c1-20(2,3)25(4,5)24-19-12-16(11-18(22)17(19)13-21)23-14-15-9-7-6-8-10-15/h6-10,16-19,21-22H,11-14H2,1-5H3/t16-,17+,18+,19+/m1/s1 |
| InChIKey | ODWHSRJGAVCLHD-XWSJACJDSA-N |
| XLogP | 3.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|