C33H62O4Si3 — CID 146028802
2-[(2R,6S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxycyclohexylidene]ethoxy-tert-butyl-dimethylsilane (PubChem CID 146028802) has the molecular formula C33H62O4Si3 and a molecular weight of 607.11 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxycyclohexylidene]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(2R,6S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxycyclohexylidene]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 146028802 |
| Molecular Formula | C33H62O4Si3 |
| Molecular Weight | 607.11 g/mol |
| Exact Mass | 606.40 |
| IUPAC Name | 2-[(2R,6S)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-phenylmethoxycyclohexylidene]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C1\[C@@H](O[Si](C)(C)C(C)(C)C)CC(OCc2ccccc2)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H62O4Si3/c1-31(2,3)38(10,11)35-22-21-28-29(36-39(12,13)32(4,5)6)23-27(34-25-26-19-17-16-18-20-26)24-30(28)37-40(14,15)33(7,8)9/h16-21,27,29-30H,22-25H2,1-15H3/b28-21-/t27?,29-,30+/m1/s1 |
| InChIKey | AEYWCFMHZLUEML-MMUGDQGWSA-N |
| XLogP | 10.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.11 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|