C35H49NO5Si — CID 44543169
(1R,2S,3S,4R,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(methylamino)-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol (PubChem CID 44543169) has the molecular formula C35H49NO5Si and a molecular weight of 591.87 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(methylamino)-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol.
| Compound Name | (1R,2S,3S,4R,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(methylamino)-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 44543169 |
| Molecular Formula | C35H49NO5Si |
| Molecular Weight | 591.87 g/mol |
| Exact Mass | 591.34 |
| IUPAC Name | (1R,2S,3S,4R,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(methylamino)-4,5,6-tris(phenylmethoxy)cyclohexan-1-ol |
| SMILES | CN[C@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H49NO5Si/c1-35(2,3)42(5,6)41-25-29-30(36-4)32(38-22-26-16-10-7-11-17-26)34(40-24-28-20-14-9-15-21-28)33(31(29)37)39-23-27-18-12-8-13-19-27/h7-21,29-34,36-37H,22-25H2,1-6H3/t29-,30+,31-,32-,33-,34-/m1/s1 |
| InChIKey | GGPCGTHIDSYNFE-VQEIZDKSSA-N |
| XLogP | 6.34 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.87 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|