C33H54O5Si2 — CID 101106224
(3R,4S,5S,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-bis(phenylmethoxy)cycloheptan-1-ol (PubChem CID 101106224) has the molecular formula C33H54O5Si2 and a molecular weight of 586.96 g/mol. Its IUPAC name is (3R,4S,5S,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-bis(phenylmethoxy)cycloheptan-1-ol.
| Compound Name | (3R,4S,5S,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-bis(phenylmethoxy)cycloheptan-1-ol |
|---|---|
| PubChem CID | 101106224 |
| Molecular Formula | C33H54O5Si2 |
| Molecular Weight | 586.96 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | (3R,4S,5S,6R)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5-bis(phenylmethoxy)cycloheptan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H54O5Si2/c1-32(2,3)39(7,8)37-28-21-27(34)22-29(38-40(9,10)33(4,5)6)31(36-24-26-19-15-12-16-20-26)30(28)35-23-25-17-13-11-14-18-25/h11-20,27-31,34H,21-24H2,1-10H3/t28-,29-,30-,31-/m1/s1 |
| InChIKey | JHVQGTUBZKNTCO-OMRVPHBLSA-N |
| XLogP | 8.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.96 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|