C19H32O4Si — CID 14160927
(2S,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-phenylmethoxyoxan-3-ol (PubChem CID 14160927) has the molecular formula C19H32O4Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (2S,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-phenylmethoxyoxan-3-ol.
| Compound Name | (2S,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 14160927 |
| Molecular Formula | C19H32O4Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (2S,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-2-phenylmethoxyoxan-3-ol |
| SMILES | C[C@H]1[C@H](O)[C@@H](OCc2ccccc2)OC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O4Si/c1-14-16(23-24(5,6)19(2,3)4)13-22-18(17(14)20)21-12-15-10-8-7-9-11-15/h7-11,14,16-18,20H,12-13H2,1-6H3/t14-,16-,17+,18+/m1/s1 |
| InChIKey | WXPSTPJEDQQAEP-BGTYHANMSA-N |
| XLogP | 3.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|