C27H40O5Si — CID 53473858
(1S,2R,3R,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-4-(phenylmethoxymethyl)cyclohexane-1,2-diol (PubChem CID 53473858) has the molecular formula C27H40O5Si and a molecular weight of 472.70 g/mol. Its IUPAC name is (1S,2R,3R,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-4-(phenylmethoxymethyl)cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-4-(phenylmethoxymethyl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 53473858 |
| Molecular Formula | C27H40O5Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (1S,2R,3R,4R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxy-4-(phenylmethoxymethyl)cyclohexane-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H40O5Si/c1-27(2,3)33(4,5)32-23-16-22(19-30-17-20-12-8-6-9-13-20)26(25(29)24(23)28)31-18-21-14-10-7-11-15-21/h6-15,22-26,28-29H,16-19H2,1-5H3/t22-,23+,24-,25-,26-/m1/s1 |
| InChIKey | GNIMGUIPZLEMGC-JQSCXEDISA-N |
| XLogP | 4.92 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|