C19H32O3Si — CID 10616882
(1R,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxycyclohexan-1-ol (PubChem CID 10616882) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is (1R,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxycyclohexan-1-ol.
| Compound Name | (1R,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 10616882 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (1R,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxycyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)CCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H32O3Si/c1-19(2,3)23(4,5)22-18-16(20)12-9-13-17(18)21-14-15-10-7-6-8-11-15/h6-8,10-11,16-18,20H,9,12-14H2,1-5H3/t16-,17-,18-/m1/s1 |
| InChIKey | OZHMJQHBHAWFSI-KZNAEPCWSA-N |
| XLogP | 4.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|