C25H36O3SSi — CID 73292656
tert-butyl-dimethyl-[(2R,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxysilane (PubChem CID 73292656) has the molecular formula C25H36O3SSi and a molecular weight of 444.71 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2R,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2R,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 73292656 |
| Molecular Formula | C25H36O3SSi |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | tert-butyl-dimethyl-[(2R,3R,4S,6S)-2-methyl-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl]oxysilane |
| SMILES | C[C@H]1O[C@@H](Sc2ccccc2)C[C@H](OCc2ccccc2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H36O3SSi/c1-19-24(28-30(5,6)25(2,3)4)22(26-18-20-13-9-7-10-14-20)17-23(27-19)29-21-15-11-8-12-16-21/h7-16,19,22-24H,17-18H2,1-6H3/t19-,22+,23+,24-/m1/s1 |
| InChIKey | IEVINJPMXVTXJY-QLBRKBSLSA-N |
| XLogP | 6.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|