C26H38O5SSi — CID 25137433
[(2R,3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyloxan-2-yl]methanol (PubChem CID 25137433) has the molecular formula C26H38O5SSi and a molecular weight of 490.74 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyloxan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 25137433 |
| Molecular Formula | C26H38O5SSi |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [(2R,3R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyloxan-2-yl]methanol |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](CO)O[C@@H](Sc3ccccc3)C[C@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H38O5SSi/c1-26(2,3)33(5,6)31-22-16-24(32-21-10-8-7-9-11-21)30-23(17-27)25(22)29-18-19-12-14-20(28-4)15-13-19/h7-15,22-25,27H,16-18H2,1-6H3/t22-,23-,24+,25+/m1/s1 |
| InChIKey | KRUKKKOISPDLRM-NGSHPTGOSA-N |
| XLogP | 5.87 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|