C46H54O6SSi — CID 11061674
(2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-ol (PubChem CID 11061674) has the molecular formula C46H54O6SSi and a molecular weight of 763.09 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-ol.
| Compound Name | (2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 11061674 |
| Molecular Formula | C46H54O6SSi |
| Molecular Weight | 763.09 g/mol |
| Exact Mass | 762.34 |
| IUPAC Name | (2R,3R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-3-methyl-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-ol |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@](C)(O)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O[C@H]2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C46H54O6SSi/c1-44(2,3)54(6,7)52-42-41(49-32-34-28-30-38(48-5)31-29-34)43(53-39-26-18-11-19-27-39)51-40(45(42,4)47)33-50-46(35-20-12-8-13-21-35,36-22-14-9-15-23-36)37-24-16-10-17-25-37/h8-31,40-43,47H,32-33H2,1-7H3/t40-,41-,42-,43+,45-/m1/s1 |
| InChIKey | LICJIPXJECAKES-BAOYYWTHSA-N |
| XLogP | 10.25 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.09 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|