C45H50O6SSi — CID 10876392
(2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-one (PubChem CID 10876392) has the molecular formula C45H50O6SSi and a molecular weight of 747.04 g/mol. Its IUPAC name is (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-one.
| Compound Name | (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-one |
|---|---|
| PubChem CID | 10876392 |
| Molecular Formula | C45H50O6SSi |
| Molecular Weight | 747.04 g/mol |
| Exact Mass | 746.31 |
| IUPAC Name | (2R,4R,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-6-phenylsulfanyl-2-(trityloxymethyl)oxan-3-one |
| SMILES | COc1ccc(CO[C@H]2[C@H](Sc3ccccc3)O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C45H50O6SSi/c1-44(2,3)53(5,6)51-41-40(46)39(50-43(52-38-25-17-10-18-26-38)42(41)48-31-33-27-29-37(47-4)30-28-33)32-49-45(34-19-11-7-12-20-34,35-21-13-8-14-22-35)36-23-15-9-16-24-36/h7-30,39,41-43H,31-32H2,1-6H3/t39-,41+,42-,43+/m1/s1 |
| InChIKey | NCDBWBYPVIAIIT-UBBMYLNBSA-N |
| XLogP | 10.07 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.04 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|